C6H13N3 — CID 158048677
methane;5-propan-2-yl-1H-1,2,4-triazole (PubChem CID 158048677) has the molecular formula C6H13N3 and a molecular weight of 127.19 g/mol. Its IUPAC name is methane;5-propan-2-yl-1H-1,2,4-triazole.
| Compound Name | methane;5-propan-2-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 158048677 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | methane;5-propan-2-yl-1H-1,2,4-triazole |
| SMILES | C.CC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C5H9N3.CH4/c1-4(2)5-6-3-7-8-5;/h3-4H,1-2H3,(H,6,7,8);1H4 |
| InChIKey | FJFGTCRBMBJMLU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |