C5H10N6 — CID 106282694
2-[1-(1H-1,2,4-triazol-5-yl)ethyl]guanidine (PubChem CID 106282694) has the molecular formula C5H10N6 and a molecular weight of 154.18 g/mol. Its IUPAC name is 2-[1-(1H-1,2,4-triazol-5-yl)ethyl]guanidine.
| Compound Name | 2-[1-(1H-1,2,4-triazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 106282694 |
| Molecular Formula | C5H10N6 |
| Molecular Weight | 154.18 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2-[1-(1H-1,2,4-triazol-5-yl)ethyl]guanidine |
| SMILES | CC(N=C(N)N)c1ncn[nH]1 |
| InChI | InChI=1S/C5H10N6/c1-3(10-5(6)7)4-8-2-9-11-4/h2-3H,1H3,(H4,6,7,10)(H,8,9,11) |
| InChIKey | XFZGCIQMIYCTEB-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.18 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|