C16H18N8 — CID 142035751
1-[(1Z)-3-(benzimidazol-1-yl)buta-1,3-dienyl]-2-[1-(1H-1,2,4-triazol-5-yl)ethyl]guanidine (PubChem CID 142035751) has the molecular formula C16H18N8 and a molecular weight of 322.38 g/mol. Its IUPAC name is 1-[(1Z)-3-(benzimidazol-1-yl)buta-1,3-dienyl]-2-[1-(1H-1,2,4-triazol-5-yl)ethyl]guanidine.
| Compound Name | 1-[(1Z)-3-(benzimidazol-1-yl)buta-1,3-dienyl]-2-[1-(1H-1,2,4-triazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 142035751 |
| Molecular Formula | C16H18N8 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-[(1Z)-3-(benzimidazol-1-yl)buta-1,3-dienyl]-2-[1-(1H-1,2,4-triazol-5-yl)ethyl]guanidine |
| SMILES | C=C(/C=C\N/C(N)=N/C(C)c1ncn[nH]1)n1cnc2ccccc21 |
| InChI | InChI=1S/C16H18N8/c1-11(24-10-20-13-5-3-4-6-14(13)24)7-8-18-16(17)22-12(2)15-19-9-21-23-15/h3-10,12H,1H2,2H3,(H3,17,18,22)(H,19,21,23)/b8-7- |
| InChIKey | PEAFDTUQWOSMKW-FPLPWBNLSA-N |
| XLogP | 1.80 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|