C14H19N5 — CID 136700074
2-[3-(benzimidazol-1-yl)propyl]-1-prop-2-enylguanidine (PubChem CID 136700074) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-[3-(benzimidazol-1-yl)propyl]-1-prop-2-enylguanidine.
| Compound Name | 2-[3-(benzimidazol-1-yl)propyl]-1-prop-2-enylguanidine |
|---|---|
| PubChem CID | 136700074 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-[3-(benzimidazol-1-yl)propyl]-1-prop-2-enylguanidine |
| SMILES | C=CCN/C(N)=N/CCCn1cnc2ccccc21 |
| InChI | InChI=1S/C14H19N5/c1-2-8-16-14(15)17-9-5-10-19-11-18-12-6-3-4-7-13(12)19/h2-4,6-7,11H,1,5,8-10H2,(H3,15,16,17) |
| InChIKey | HPZANMGJOBKBOJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|