C13H18N4S — CID 134202281
3-(benzimidazol-1-yl)propyl N'-ethylcarbamimidothioate (PubChem CID 134202281) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is 3-(benzimidazol-1-yl)propyl N'-ethylcarbamimidothioate.
| Compound Name | 3-(benzimidazol-1-yl)propyl N'-ethylcarbamimidothioate |
|---|---|
| PubChem CID | 134202281 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-(benzimidazol-1-yl)propyl N'-ethylcarbamimidothioate |
| SMILES | CC/N=C(\N)SCCCn1cnc2ccccc21 |
| InChI | InChI=1S/C13H18N4S/c1-2-15-13(14)18-9-5-8-17-10-16-11-6-3-4-7-12(11)17/h3-4,6-7,10H,2,5,8-9H2,1H3,(H2,14,15) |
| InChIKey | JDWPYCWSZUWGIN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|