C15H23N5 — CID 111032826
2-[3-(benzimidazol-1-yl)propyl]-1-tert-butylguanidine (PubChem CID 111032826) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-[3-(benzimidazol-1-yl)propyl]-1-tert-butylguanidine.
| Compound Name | 2-[3-(benzimidazol-1-yl)propyl]-1-tert-butylguanidine |
|---|---|
| PubChem CID | 111032826 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 2-[3-(benzimidazol-1-yl)propyl]-1-tert-butylguanidine |
| SMILES | CC(C)(C)N/C(N)=N/CCCn1cnc2ccccc21 |
| InChI | InChI=1S/C15H23N5/c1-15(2,3)19-14(16)17-9-6-10-20-11-18-12-7-4-5-8-13(12)20/h4-5,7-8,11H,6,9-10H2,1-3H3,(H3,16,17,19) |
| InChIKey | QAPFZFGHKDPHDL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|