C17H16N2O5 — CID 162745377
ethyl (Z)-2-(benzimidazol-1-yl)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate (PubChem CID 162745377) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is ethyl (Z)-2-(benzimidazol-1-yl)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate.
| Compound Name | ethyl (Z)-2-(benzimidazol-1-yl)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate |
|---|---|
| PubChem CID | 162745377 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | ethyl (Z)-2-(benzimidazol-1-yl)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/OC1C=C(C)C(=O)O1)n1cnc2ccccc21 |
| InChI | InChI=1S/C17H16N2O5/c1-3-22-17(21)14(9-23-15-8-11(2)16(20)24-15)19-10-18-12-6-4-5-7-13(12)19/h4-10,15H,3H2,1-2H3/b14-9- |
| InChIKey | IGULQIZIVGUOFM-ZROIWOOFSA-N |
| XLogP | 2.24 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|