C16H15N3O5 — CID 162745406
ethyl (Z)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]-2-pyrrolo[2,3-b]pyrazin-5-ylprop-2-enoate (PubChem CID 162745406) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is ethyl (Z)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]-2-pyrrolo[2,3-b]pyrazin-5-ylprop-2-enoate.
| Compound Name | ethyl (Z)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]-2-pyrrolo[2,3-b]pyrazin-5-ylprop-2-enoate |
|---|---|
| PubChem CID | 162745406 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | ethyl (Z)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]-2-pyrrolo[2,3-b]pyrazin-5-ylprop-2-enoate |
| SMILES | CCOC(=O)/C(=C/OC1C=C(C)C(=O)O1)n1ccc2nccnc21 |
| InChI | InChI=1S/C16H15N3O5/c1-3-22-16(21)12(9-23-13-8-10(2)15(20)24-13)19-7-4-11-14(19)18-6-5-17-11/h4-9,13H,3H2,1-2H3/b12-9- |
| InChIKey | XXLQJPCPXGNKRA-XFXZXTDPSA-N |
| XLogP | 1.64 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|