C19H16F3NO5 — CID 162745396
ethyl (Z)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]-2-[5-(trifluoromethyl)indol-1-yl]prop-2-enoate (PubChem CID 162745396) has the molecular formula C19H16F3NO5 and a molecular weight of 395.33 g/mol. Its IUPAC name is ethyl (Z)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]-2-[5-(trifluoromethyl)indol-1-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]-2-[5-(trifluoromethyl)indol-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 162745396 |
| Molecular Formula | C19H16F3NO5 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | ethyl (Z)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]-2-[5-(trifluoromethyl)indol-1-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/OC1C=C(C)C(=O)O1)n1ccc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C19H16F3NO5/c1-3-26-18(25)15(10-27-16-8-11(2)17(24)28-16)23-7-6-12-9-13(19(20,21)22)4-5-14(12)23/h4-10,16H,3H2,1-2H3/b15-10- |
| InChIKey | GOSYJDRSHUOQPW-GDNBJRDFSA-N |
| XLogP | 3.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|