C20H24N2O10 — CID 21143452
diethyl (Z)-2-[3-[(Z)-1,4-diethoxy-1,4-dioxobut-2-en-2-yl]-2,4-dioxopyrimidin-1-yl]but-2-enedioate (PubChem CID 21143452) has the molecular formula C20H24N2O10 and a molecular weight of 452.42 g/mol. Its IUPAC name is diethyl (Z)-2-[3-[(Z)-1,4-diethoxy-1,4-dioxobut-2-en-2-yl]-2,4-dioxopyrimidin-1-yl]but-2-enedioate.
| Compound Name | diethyl (Z)-2-[3-[(Z)-1,4-diethoxy-1,4-dioxobut-2-en-2-yl]-2,4-dioxopyrimidin-1-yl]but-2-enedioate |
|---|---|
| PubChem CID | 21143452 |
| Molecular Formula | C20H24N2O10 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | diethyl (Z)-2-[3-[(Z)-1,4-diethoxy-1,4-dioxobut-2-en-2-yl]-2,4-dioxopyrimidin-1-yl]but-2-enedioate |
| SMILES | CCOC(=O)/C=C(/C(=O)OCC)n1ccc(=O)n(/C(=C\C(=O)OCC)C(=O)OCC)c1=O |
| InChI | InChI=1S/C20H24N2O10/c1-5-29-16(24)11-13(18(26)31-7-3)21-10-9-15(23)22(20(21)28)14(19(27)32-8-4)12-17(25)30-6-2/h9-12H,5-8H2,1-4H3/b13-11-,14-12- |
| InChIKey | UPHYNRRUSIKYTL-XSYHWHKQSA-N |
| XLogP | -0.06 |
| TPSA | 149.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|