C15H17FN2O6 — CID 15404771
diethyl (Z)-2-(5-fluoro-2,4-dioxo-3-prop-2-enylpyrimidin-1-yl)but-2-enedioate (PubChem CID 15404771) has the molecular formula C15H17FN2O6 and a molecular weight of 340.31 g/mol. Its IUPAC name is diethyl (Z)-2-(5-fluoro-2,4-dioxo-3-prop-2-enylpyrimidin-1-yl)but-2-enedioate.
| Compound Name | diethyl (Z)-2-(5-fluoro-2,4-dioxo-3-prop-2-enylpyrimidin-1-yl)but-2-enedioate |
|---|---|
| PubChem CID | 15404771 |
| Molecular Formula | C15H17FN2O6 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | diethyl (Z)-2-(5-fluoro-2,4-dioxo-3-prop-2-enylpyrimidin-1-yl)but-2-enedioate |
| SMILES | C=CCn1c(=O)c(F)cn(/C(=C\C(=O)OCC)C(=O)OCC)c1=O |
| InChI | InChI=1S/C15H17FN2O6/c1-4-7-17-13(20)10(16)9-18(15(17)22)11(14(21)24-6-3)8-12(19)23-5-2/h4,8-9H,1,5-7H2,2-3H3/b11-8- |
| InChIKey | QDQJETZDSSLDMB-FLIBITNWSA-N |
| XLogP | 0.30 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|