C19H20N2O4 — CID 146163987
ethyl 4-[2,4-dioxo-1,3-bis(prop-2-enyl)pyrimidin-5-yl]benzoate (PubChem CID 146163987) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is ethyl 4-[2,4-dioxo-1,3-bis(prop-2-enyl)pyrimidin-5-yl]benzoate.
| Compound Name | ethyl 4-[2,4-dioxo-1,3-bis(prop-2-enyl)pyrimidin-5-yl]benzoate |
|---|---|
| PubChem CID | 146163987 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | ethyl 4-[2,4-dioxo-1,3-bis(prop-2-enyl)pyrimidin-5-yl]benzoate |
| SMILES | C=CCn1cc(-c2ccc(C(=O)OCC)cc2)c(=O)n(CC=C)c1=O |
| InChI | InChI=1S/C19H20N2O4/c1-4-11-20-13-16(17(22)21(12-5-2)19(20)24)14-7-9-15(10-8-14)18(23)25-6-3/h4-5,7-10,13H,1-2,6,11-12H2,3H3 |
| InChIKey | IYIGIPNNEWUBIN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|