C16H21N2O2+ — CID 766694
ethyl 1-ethyl-2-methyl-3-prop-2-enylbenzimidazol-1-ium-5-carboxylate (PubChem CID 766694) has the molecular formula C16H21N2O2+ and a molecular weight of 273.36 g/mol. Its IUPAC name is ethyl 1-ethyl-2-methyl-3-prop-2-enylbenzimidazol-1-ium-5-carboxylate.
| Compound Name | ethyl 1-ethyl-2-methyl-3-prop-2-enylbenzimidazol-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 766694 |
| Molecular Formula | C16H21N2O2+ |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | ethyl 1-ethyl-2-methyl-3-prop-2-enylbenzimidazol-1-ium-5-carboxylate |
| SMILES | C=CCn1c(C)[n+](CC)c2ccc(C(=O)OCC)cc21 |
| InChI | InChI=1S/C16H21N2O2/c1-5-10-18-12(4)17(6-2)14-9-8-13(11-15(14)18)16(19)20-7-3/h5,8-9,11H,1,6-7,10H2,2-4H3/q+1 |
| InChIKey | BVPIGWWCEKKGLO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|