C22H26N3O3+ — CID 8829930
ethyl 3-[2-(benzylamino)-2-oxoethyl]-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate (PubChem CID 8829930) has the molecular formula C22H26N3O3+ and a molecular weight of 380.47 g/mol. Its IUPAC name is ethyl 3-[2-(benzylamino)-2-oxoethyl]-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate.
| Compound Name | ethyl 3-[2-(benzylamino)-2-oxoethyl]-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 8829930 |
| Molecular Formula | C22H26N3O3+ |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | ethyl 3-[2-(benzylamino)-2-oxoethyl]-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)n(CC(=O)NCc1ccccc1)c(C)[n+]2CC |
| InChI | InChI=1S/C22H25N3O3/c1-4-24-16(3)25(15-21(26)23-14-17-9-7-6-8-10-17)20-13-18(11-12-19(20)24)22(27)28-5-2/h6-13H,4-5,14-15H2,1-3H3/p+1 |
| InChIKey | GVURJQWVSYPBLG-UHFFFAOYSA-O |
| XLogP | 2.75 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|