C23H28N3O3+ — CID 8829963
ethyl 1-ethyl-2-methyl-3-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]benzimidazol-1-ium-5-carboxylate (PubChem CID 8829963) has the molecular formula C23H28N3O3+ and a molecular weight of 394.50 g/mol. Its IUPAC name is ethyl 1-ethyl-2-methyl-3-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]benzimidazol-1-ium-5-carboxylate.
| Compound Name | ethyl 1-ethyl-2-methyl-3-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]benzimidazol-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 8829963 |
| Molecular Formula | C23H28N3O3+ |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | ethyl 1-ethyl-2-methyl-3-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]benzimidazol-1-ium-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)n(CC(=O)N[C@H](C)c1ccccc1)c(C)[n+]2CC |
| InChI | InChI=1S/C23H27N3O3/c1-5-25-17(4)26(15-22(27)24-16(3)18-10-8-7-9-11-18)21-14-19(12-13-20(21)25)23(28)29-6-2/h7-14,16H,5-6,15H2,1-4H3/p+1/t16-/m1/s1 |
| InChIKey | OOBFQZVMUAPCGF-MRXNPFEDSA-O |
| XLogP | 3.31 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|