C24H28N3O3+ — CID 8829585
ethyl 3-[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl]-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate (PubChem CID 8829585) has the molecular formula C24H28N3O3+ and a molecular weight of 406.51 g/mol. Its IUPAC name is ethyl 3-[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl]-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate.
| Compound Name | ethyl 3-[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl]-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 8829585 |
| Molecular Formula | C24H28N3O3+ |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | ethyl 3-[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl]-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)n(CC(=O)Nc1ccc3c(c1)CCC3)c(C)[n+]2CC |
| InChI | InChI=1S/C24H27N3O3/c1-4-26-16(3)27(22-14-19(10-12-21(22)26)24(29)30-5-2)15-23(28)25-20-11-9-17-7-6-8-18(17)13-20/h9-14H,4-8,15H2,1-3H3/p+1 |
| InChIKey | TYBFRGYEBSFHJI-UHFFFAOYSA-O |
| XLogP | 3.56 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|