C21H33N2O2+ — CID 2246038
ethyl 1-ethyl-2-methyl-3-octylbenzimidazol-1-ium-5-carboxylate (PubChem CID 2246038) has the molecular formula C21H33N2O2+ and a molecular weight of 345.51 g/mol. Its IUPAC name is ethyl 1-ethyl-2-methyl-3-octylbenzimidazol-1-ium-5-carboxylate.
| Compound Name | ethyl 1-ethyl-2-methyl-3-octylbenzimidazol-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 2246038 |
| Molecular Formula | C21H33N2O2+ |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | ethyl 1-ethyl-2-methyl-3-octylbenzimidazol-1-ium-5-carboxylate |
| SMILES | CCCCCCCCn1c(C)[n+](CC)c2ccc(C(=O)OCC)cc21 |
| InChI | InChI=1S/C21H33N2O2/c1-5-8-9-10-11-12-15-23-17(4)22(6-2)19-14-13-18(16-20(19)23)21(24)25-7-3/h13-14,16H,5-12,15H2,1-4H3/q+1 |
| InChIKey | GCCVZBDVTUZQRQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|