C19H28F3N2O2S+ — CID 2835803
1-ethyl-2-methyl-3-octyl-5-(trifluoromethylsulfonyl)benzimidazol-1-ium (PubChem CID 2835803) has the molecular formula C19H28F3N2O2S+ and a molecular weight of 405.51 g/mol. Its IUPAC name is 1-ethyl-2-methyl-3-octyl-5-(trifluoromethylsulfonyl)benzimidazol-1-ium.
| Compound Name | 1-ethyl-2-methyl-3-octyl-5-(trifluoromethylsulfonyl)benzimidazol-1-ium |
|---|---|
| PubChem CID | 2835803 |
| Molecular Formula | C19H28F3N2O2S+ |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 1-ethyl-2-methyl-3-octyl-5-(trifluoromethylsulfonyl)benzimidazol-1-ium |
| SMILES | CCCCCCCCn1c(C)[n+](CC)c2ccc(S(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C19H28F3N2O2S/c1-4-6-7-8-9-10-13-24-15(3)23(5-2)17-12-11-16(14-18(17)24)27(25,26)19(20,21)22/h11-12,14H,4-10,13H2,1-3H3/q+1 |
| InChIKey | XJLJYHJYZXMRPS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 42.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|