C19H28F3N2+ — CID 153338189
1-decyl-3-methyl-2-(trifluoromethyl)benzimidazol-3-ium (PubChem CID 153338189) has the molecular formula C19H28F3N2+ and a molecular weight of 341.44 g/mol. Its IUPAC name is 1-decyl-3-methyl-2-(trifluoromethyl)benzimidazol-3-ium.
| Compound Name | 1-decyl-3-methyl-2-(trifluoromethyl)benzimidazol-3-ium |
|---|---|
| PubChem CID | 153338189 |
| Molecular Formula | C19H28F3N2+ |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 1-decyl-3-methyl-2-(trifluoromethyl)benzimidazol-3-ium |
| SMILES | CCCCCCCCCCn1c(C(F)(F)F)[n+](C)c2ccccc21 |
| InChI | InChI=1S/C19H28F3N2/c1-3-4-5-6-7-8-9-12-15-24-17-14-11-10-13-16(17)23(2)18(24)19(20,21)22/h10-11,13-14H,3-9,12,15H2,1-2H3/q+1 |
| InChIKey | LKGAMCNSOPKZGA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|