C16H25N2+ — CID 155764044
1,3-dimethyl-2-(2-methylhexan-2-yl)benzimidazol-3-ium (PubChem CID 155764044) has the molecular formula C16H25N2+ and a molecular weight of 245.39 g/mol. Its IUPAC name is 1,3-dimethyl-2-(2-methylhexan-2-yl)benzimidazol-3-ium.
| Compound Name | 1,3-dimethyl-2-(2-methylhexan-2-yl)benzimidazol-3-ium |
|---|---|
| PubChem CID | 155764044 |
| Molecular Formula | C16H25N2+ |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | 1,3-dimethyl-2-(2-methylhexan-2-yl)benzimidazol-3-ium |
| SMILES | CCCCC(C)(C)c1n(C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C16H25N2/c1-6-7-12-16(2,3)15-17(4)13-10-8-9-11-14(13)18(15)5/h8-11H,6-7,12H2,1-5H3/q+1 |
| InChIKey | QBDVMJMOBGYCQF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|