C20H31F3N2O4S — CID 153338188
1-decyl-3-methyl-2-(trifluoromethyl)benzimidazol-3-ium;methyl sulfate (PubChem CID 153338188) has the molecular formula C20H31F3N2O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is 1-decyl-3-methyl-2-(trifluoromethyl)benzimidazol-3-ium;methyl sulfate.
| Compound Name | 1-decyl-3-methyl-2-(trifluoromethyl)benzimidazol-3-ium;methyl sulfate |
|---|---|
| PubChem CID | 153338188 |
| Molecular Formula | C20H31F3N2O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 1-decyl-3-methyl-2-(trifluoromethyl)benzimidazol-3-ium;methyl sulfate |
| SMILES | CCCCCCCCCCn1c(C(F)(F)F)[n+](C)c2ccccc21.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C19H28F3N2.CH4O4S/c1-3-4-5-6-7-8-9-12-15-24-17-14-11-10-13-16(17)23(2)18(24)19(20,21)22;1-5-6(2,3)4/h10-11,13-14H,3-9,12,15H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | IXRFVBKVYMOXKH-UHFFFAOYSA-M |
| XLogP | 4.72 |
| TPSA | 75.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|