C13H16F3N2O3S+ — CID 130215055
4-[3-methyl-2-(trifluoromethyl)benzimidazol-3-ium-1-yl]butane-1-sulfonic acid (PubChem CID 130215055) has the molecular formula C13H16F3N2O3S+ and a molecular weight of 337.34 g/mol. Its IUPAC name is 4-[3-methyl-2-(trifluoromethyl)benzimidazol-3-ium-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[3-methyl-2-(trifluoromethyl)benzimidazol-3-ium-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 130215055 |
| Molecular Formula | C13H16F3N2O3S+ |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 4-[3-methyl-2-(trifluoromethyl)benzimidazol-3-ium-1-yl]butane-1-sulfonic acid |
| SMILES | C[n+]1c(C(F)(F)F)n(CCCCS(=O)(=O)O)c2ccccc21 |
| InChI | InChI=1S/C13H15F3N2O3S/c1-17-10-6-2-3-7-11(10)18(12(17)13(14,15)16)8-4-5-9-22(19,20)21/h2-3,6-7H,4-5,8-9H2,1H3/p+1 |
| InChIKey | INZYTOQBNSNLSP-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 63.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|