C18H22N4O8S2 — CID 132540227
4-[2,4-dioxo-3-(4-sulfobutyl)benzo[g]pteridin-10-yl]butane-1-sulfonic acid (PubChem CID 132540227) has the molecular formula C18H22N4O8S2 and a molecular weight of 486.53 g/mol. Its IUPAC name is 4-[2,4-dioxo-3-(4-sulfobutyl)benzo[g]pteridin-10-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2,4-dioxo-3-(4-sulfobutyl)benzo[g]pteridin-10-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 132540227 |
| Molecular Formula | C18H22N4O8S2 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 4-[2,4-dioxo-3-(4-sulfobutyl)benzo[g]pteridin-10-yl]butane-1-sulfonic acid |
| SMILES | O=c1nc2n(CCCCS(=O)(=O)O)c3ccccc3nc-2c(=O)n1CCCCS(=O)(=O)O |
| InChI | InChI=1S/C18H22N4O8S2/c23-17-15-16(20-18(24)22(17)10-4-6-12-32(28,29)30)21(9-3-5-11-31(25,26)27)14-8-2-1-7-13(14)19-15/h1-2,7-8H,3-6,9-12H2,(H,25,26,27)(H,28,29,30) |
| InChIKey | NWPUHMKLMJSTBQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 178.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|