C17H20N4O2 — CID 14430190
10-hexyl-3-methylbenzo[g]pteridine-2,4-dione (PubChem CID 14430190) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 10-hexyl-3-methylbenzo[g]pteridine-2,4-dione.
| Compound Name | 10-hexyl-3-methylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 14430190 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 10-hexyl-3-methylbenzo[g]pteridine-2,4-dione |
| SMILES | CCCCCCn1c2nc(=O)n(C)c(=O)c-2nc2ccccc21 |
| InChI | InChI=1S/C17H20N4O2/c1-3-4-5-8-11-21-13-10-7-6-9-12(13)18-14-15(21)19-17(23)20(2)16(14)22/h6-7,9-10H,3-5,8,11H2,1-2H3 |
| InChIKey | LKNDYWKKRUPDNL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|