C19H15BrN4O2 — CID 10501753
3-(3-bromopropyl)-10-phenylbenzo[g]pteridine-2,4-dione (PubChem CID 10501753) has the molecular formula C19H15BrN4O2 and a molecular weight of 411.26 g/mol. Its IUPAC name is 3-(3-bromopropyl)-10-phenylbenzo[g]pteridine-2,4-dione.
| Compound Name | 3-(3-bromopropyl)-10-phenylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 10501753 |
| Molecular Formula | C19H15BrN4O2 |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 3-(3-bromopropyl)-10-phenylbenzo[g]pteridine-2,4-dione |
| SMILES | O=c1nc2n(-c3ccccc3)c3ccccc3nc-2c(=O)n1CCCBr |
| InChI | InChI=1S/C19H15BrN4O2/c20-11-6-12-23-18(25)16-17(22-19(23)26)24(13-7-2-1-3-8-13)15-10-5-4-9-14(15)21-16/h1-5,7-10H,6,11-12H2 |
| InChIKey | VBUAKIMCJTVWNH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|