C16H11N5O2 — CID 15192393
3-methyl-10-pyridin-3-ylbenzo[g]pteridine-2,4-dione (PubChem CID 15192393) has the molecular formula C16H11N5O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 3-methyl-10-pyridin-3-ylbenzo[g]pteridine-2,4-dione.
| Compound Name | 3-methyl-10-pyridin-3-ylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 15192393 |
| Molecular Formula | C16H11N5O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3-methyl-10-pyridin-3-ylbenzo[g]pteridine-2,4-dione |
| SMILES | Cn1c(=O)nc2n(-c3cccnc3)c3ccccc3nc-2c1=O |
| InChI | InChI=1S/C16H11N5O2/c1-20-15(22)13-14(19-16(20)23)21(10-5-4-8-17-9-10)12-7-3-2-6-11(12)18-13/h2-9H,1H3 |
| InChIKey | XPLJVTKXYPAXEB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 82.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|