C56H36N8O3 — CID 136734332
3-[2-oxo-2-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)ethyl]-10-phenylbenzo[g]pteridine-2,4-dione (PubChem CID 136734332) has the molecular formula C56H36N8O3 and a molecular weight of 868.96 g/mol. Its IUPAC name is 3-[2-oxo-2-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)ethyl]-10-phenylbenzo[g]pteridine-2,4-dione.
| Compound Name | 3-[2-oxo-2-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)ethyl]-10-phenylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 136734332 |
| Molecular Formula | C56H36N8O3 |
| Molecular Weight | 868.96 g/mol |
| Exact Mass | 868.29 |
| IUPAC Name | 3-[2-oxo-2-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)ethyl]-10-phenylbenzo[g]pteridine-2,4-dione |
| SMILES | O=C(Cn1c(=O)nc2n(-c3ccccc3)c3ccccc3nc-2c1=O)c1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C56H36N8O3/c65-48(33-63-55(66)53-54(62-56(63)67)64(37-21-11-4-12-22-37)47-24-14-13-23-38(47)61-53)52-45-31-29-43(59-45)50(35-17-7-2-8-18-35)41-27-25-39(57-41)49(34-15-5-1-6-16-34)40-26-28-42(58-40)51(36-19-9-3-10-20-36)44-30-32-46(52)60-44/h1-32,57,60H,33H2/b49-39-,49-40-,50-41-,50-43-,51-42-,51-44-,52-45+,52-46+ |
| InChIKey | WSSPZPHLGRLGSZ-GNLSSMNVSA-N |
| XLogP | 10.90 |
| TPSA | 144.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.96 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|