C52H32N6O4 — CID 136703643
1-[4-[20-[4-(2,5-dioxopyrrol-1-yl)phenyl]-10,15-diphenyl-21,23-dihydroporphyrin-5-yl]phenyl]pyrrole-2,5-dione (PubChem CID 136703643) has the molecular formula C52H32N6O4 and a molecular weight of 804.87 g/mol. Its IUPAC name is 1-[4-[20-[4-(2,5-dioxopyrrol-1-yl)phenyl]-10,15-diphenyl-21,23-dihydroporphyrin-5-yl]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[20-[4-(2,5-dioxopyrrol-1-yl)phenyl]-10,15-diphenyl-21,23-dihydroporphyrin-5-yl]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 136703643 |
| Molecular Formula | C52H32N6O4 |
| Molecular Weight | 804.87 g/mol |
| Exact Mass | 804.25 |
| IUPAC Name | 1-[4-[20-[4-(2,5-dioxopyrrol-1-yl)phenyl]-10,15-diphenyl-21,23-dihydroporphyrin-5-yl]phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccc(N6C(=O)C=CC6=O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C52H32N6O4/c59-45-27-28-46(60)57(45)35-15-11-33(12-16-35)51-41-23-21-39(54-41)49(31-7-3-1-4-8-31)37-19-20-38(53-37)50(32-9-5-2-6-10-32)40-22-24-42(55-40)52(44-26-25-43(51)56-44)34-13-17-36(18-14-34)58-47(61)29-30-48(58)62/h1-30,53,56H/b49-37-,49-39-,50-38-,50-40-,51-41-,51-43-,52-42-,52-44- |
| InChIKey | YUWUTQCCCSYLEG-RDPSGJMCSA-N |
| XLogP | 10.18 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.87 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|