C48H33N5O3 — CID 137248530
4-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]morpholine-3,5-dione (PubChem CID 137248530) has the molecular formula C48H33N5O3 and a molecular weight of 727.82 g/mol. Its IUPAC name is 4-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]morpholine-3,5-dione.
| Compound Name | 4-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]morpholine-3,5-dione |
|---|---|
| PubChem CID | 137248530 |
| Molecular Formula | C48H33N5O3 |
| Molecular Weight | 727.82 g/mol |
| Exact Mass | 727.26 |
| IUPAC Name | 4-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]morpholine-3,5-dione |
| SMILES | O=C1COCC(=O)N1c1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C48H33N5O3/c54-43-28-56-29-44(55)53(43)34-18-16-33(17-19-34)48-41-26-24-39(51-41)46(31-12-6-2-7-13-31)37-22-20-35(49-37)45(30-10-4-1-5-11-30)36-21-23-38(50-36)47(32-14-8-3-9-15-32)40-25-27-42(48)52-40/h1-27,49,52H,28-29H2/b45-35-,45-36-,46-37-,46-39-,47-38-,47-40-,48-41-,48-42- |
| InChIKey | HVBTXGPSMRIXRX-MPSQMXPISA-N |
| XLogP | 10.21 |
| TPSA | 103.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.82 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|