C53H36ClN5OS — CID 137178215
2-(4-chlorophenyl)-3-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]-1,3-thiazolidin-4-one (PubChem CID 137178215) has the molecular formula C53H36ClN5OS and a molecular weight of 826.43 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-chlorophenyl)-3-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137178215 |
| Molecular Formula | C53H36ClN5OS |
| Molecular Weight | 826.43 g/mol |
| Exact Mass | 825.23 |
| IUPAC Name | 2-(4-chlorophenyl)-3-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccc(Cl)cc2)N1c1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C53H36ClN5OS/c54-38-20-16-37(17-21-38)53-59(48(60)32-61-53)39-22-18-36(19-23-39)52-46-30-28-44(57-46)50(34-12-6-2-7-13-34)42-26-24-40(55-42)49(33-10-4-1-5-11-33)41-25-27-43(56-41)51(35-14-8-3-9-15-35)45-29-31-47(52)58-45/h1-31,53,55,58H,32H2/b49-40-,49-41-,50-42-,50-44-,51-43-,51-45-,52-46-,52-47- |
| InChIKey | PSEUQPAIYHKXKN-IXAFCNGASA-N |
| XLogP | 13.76 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.43 |
| LogP ≤ 5 | 13.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |