C46H32N4 — CID 11585655
5,10,20-triphenyl-15-(1-phenylethenyl)-21,22-dihydroporphyrin (PubChem CID 11585655) has the molecular formula C46H32N4 and a molecular weight of 640.79 g/mol. Its IUPAC name is 5,10,20-triphenyl-15-(1-phenylethenyl)-21,22-dihydroporphyrin.
| Compound Name | 5,10,20-triphenyl-15-(1-phenylethenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11585655 |
| Molecular Formula | C46H32N4 |
| Molecular Weight | 640.79 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | 5,10,20-triphenyl-15-(1-phenylethenyl)-21,22-dihydroporphyrin |
| SMILES | C=C(c1ccccc1)c1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc1C=C3)C=C2 |
| InChI | InChI=1S/C46H32N4/c1-30(31-14-6-2-7-15-31)43-35-22-24-37(47-35)44(32-16-8-3-9-17-32)39-26-28-41(49-39)46(34-20-12-5-13-21-34)42-29-27-40(50-42)45(33-18-10-4-11-19-33)38-25-23-36(43)48-38/h2-29,49-50H,1H2/b43-35-,43-36-,44-37-,44-39-,45-38-,45-40-,46-41-,46-42- |
| InChIKey | WYQVKRWFEKHDEN-CRLDETFASA-N |
| XLogP | 11.72 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.79 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |