C43H32N4 — CID 165365897
5-[(3E)-penta-1,3-dien-3-yl]-10,15,20-triphenyl-21,23-dihydroporphyrin (PubChem CID 165365897) has the molecular formula C43H32N4 and a molecular weight of 604.76 g/mol. Its IUPAC name is 5-[(3E)-penta-1,3-dien-3-yl]-10,15,20-triphenyl-21,23-dihydroporphyrin.
| Compound Name | 5-[(3E)-penta-1,3-dien-3-yl]-10,15,20-triphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 165365897 |
| Molecular Formula | C43H32N4 |
| Molecular Weight | 604.76 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | 5-[(3E)-penta-1,3-dien-3-yl]-10,15,20-triphenyl-21,23-dihydroporphyrin |
| SMILES | C=C/C(=C\C)c1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C43H32N4/c1-3-28(4-2)40-32-20-22-34(44-32)41(29-14-8-5-9-15-29)36-24-26-38(46-36)43(31-18-12-7-13-19-31)39-27-25-37(47-39)42(30-16-10-6-11-17-30)35-23-21-33(40)45-35/h3-27,44,47H,1H2,2H3/b28-4+,40-32-,40-33-,41-34-,41-36-,42-35-,42-37-,43-38-,43-39- |
| InChIKey | KKIAFZMKUJSFDN-VWCWDWFNSA-N |
| XLogP | 11.25 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.76 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|