C50H44N4O2 — CID 135451900
(Z)-2,2,7,7-tetramethyl-4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)oct-4-ene-3,6-dione (PubChem CID 135451900) has the molecular formula C50H44N4O2 and a molecular weight of 732.93 g/mol. Its IUPAC name is (Z)-2,2,7,7-tetramethyl-4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)oct-4-ene-3,6-dione.
| Compound Name | (Z)-2,2,7,7-tetramethyl-4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)oct-4-ene-3,6-dione |
|---|---|
| PubChem CID | 135451900 |
| Molecular Formula | C50H44N4O2 |
| Molecular Weight | 732.93 g/mol |
| Exact Mass | 732.35 |
| IUPAC Name | (Z)-2,2,7,7-tetramethyl-4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)oct-4-ene-3,6-dione |
| SMILES | CC(C)(C)C(=O)/C=C(\C(=O)C(C)(C)C)c1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C50H44N4O2/c1-49(2,3)43(55)30-34(48(56)50(4,5)6)47-41-28-26-39(53-41)45(32-18-12-8-13-19-32)37-24-22-35(51-37)44(31-16-10-7-11-17-31)36-23-25-38(52-36)46(33-20-14-9-15-21-33)40-27-29-42(47)54-40/h7-30,51,54H,1-6H3/b34-30-,44-35-,44-36-,45-37-,45-39-,46-38-,46-40-,47-41-,47-42- |
| InChIKey | QTSIZHABVFUVEW-VKIUKDAYSA-N |
| XLogP | 12.27 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.93 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|