C48H34N4O2S2 — CID 136717588
S-[4-[15-(4-acetylsulfanylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]phenyl] ethanethioate (PubChem CID 136717588) has the molecular formula C48H34N4O2S2 and a molecular weight of 762.96 g/mol. Its IUPAC name is S-[4-[15-(4-acetylsulfanylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]phenyl] ethanethioate.
| Compound Name | S-[4-[15-(4-acetylsulfanylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]phenyl] ethanethioate |
|---|---|
| PubChem CID | 136717588 |
| Molecular Formula | C48H34N4O2S2 |
| Molecular Weight | 762.96 g/mol |
| Exact Mass | 762.21 |
| IUPAC Name | S-[4-[15-(4-acetylsulfanylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]phenyl] ethanethioate |
| SMILES | CC(=O)Sc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccc(SC(C)=O)cc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C48H34N4O2S2/c1-29(53)55-35-17-13-33(14-18-35)47-41-25-21-37(49-41)45(31-9-5-3-6-10-31)39-23-27-43(51-39)48(34-15-19-36(20-16-34)56-30(2)54)44-28-24-40(52-44)46(32-11-7-4-8-12-32)38-22-26-42(47)50-38/h3-28,49,52H,1-2H3/b45-37-,45-39-,46-38-,46-40-,47-41-,47-42-,48-43-,48-44- |
| InChIKey | GMTZNQFUSGBXOO-UDTYQVGYSA-N |
| XLogP | 12.60 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.96 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|