C45H30N4S3 — CID 137302487
[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]sulfanylmethanedithioic acid (PubChem CID 137302487) has the molecular formula C45H30N4S3 and a molecular weight of 722.96 g/mol. Its IUPAC name is [4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]sulfanylmethanedithioic acid.
| Compound Name | [4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]sulfanylmethanedithioic acid |
|---|---|
| PubChem CID | 137302487 |
| Molecular Formula | C45H30N4S3 |
| Molecular Weight | 722.96 g/mol |
| Exact Mass | 722.16 |
| IUPAC Name | [4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]sulfanylmethanedithioic acid |
| SMILES | S=C(S)Sc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C45H30N4S3/c50-45(51)52-32-18-16-31(17-19-32)44-39-26-24-37(48-39)42(29-12-6-2-7-13-29)35-22-20-33(46-35)41(28-10-4-1-5-11-28)34-21-23-36(47-34)43(30-14-8-3-9-15-30)38-25-27-40(44)49-38/h1-27,46,49H,(H,50,51)/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | FIUWTQVEPWJRFM-LWQDQPMZSA-N |
| XLogP | 12.63 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.96 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|