C25H19N4O5P — CID 132519081
[(E)-2-[4-[(2,4-dioxo-10-phenylbenzo[g]pteridin-3-yl)methyl]phenyl]ethenyl]phosphonic acid (PubChem CID 132519081) has the molecular formula C25H19N4O5P and a molecular weight of 486.42 g/mol. Its IUPAC name is [(E)-2-[4-[(2,4-dioxo-10-phenylbenzo[g]pteridin-3-yl)methyl]phenyl]ethenyl]phosphonic acid.
| Compound Name | [(E)-2-[4-[(2,4-dioxo-10-phenylbenzo[g]pteridin-3-yl)methyl]phenyl]ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 132519081 |
| Molecular Formula | C25H19N4O5P |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | [(E)-2-[4-[(2,4-dioxo-10-phenylbenzo[g]pteridin-3-yl)methyl]phenyl]ethenyl]phosphonic acid |
| SMILES | O=c1nc2n(-c3ccccc3)c3ccccc3nc-2c(=O)n1Cc1ccc(/C=C/P(=O)(O)O)cc1 |
| InChI | InChI=1S/C25H19N4O5P/c30-24-22-23(29(19-6-2-1-3-7-19)21-9-5-4-8-20(21)26-22)27-25(31)28(24)16-18-12-10-17(11-13-18)14-15-35(32,33)34/h1-15H,16H2,(H2,32,33,34)/b15-14+ |
| InChIKey | YFTXKFNMEADFON-CCEZHUSRSA-N |
| XLogP | 3.24 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|