C13H18N2O3S — CID 18415223
6-(benzimidazol-1-yl)hexane-1-sulfonic acid (PubChem CID 18415223) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is 6-(benzimidazol-1-yl)hexane-1-sulfonic acid.
| Compound Name | 6-(benzimidazol-1-yl)hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 18415223 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 6-(benzimidazol-1-yl)hexane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCCCn1cnc2ccccc21 |
| InChI | InChI=1S/C13H18N2O3S/c16-19(17,18)10-6-2-1-5-9-15-11-14-12-7-3-4-8-13(12)15/h3-4,7-8,11H,1-2,5-6,9-10H2,(H,16,17,18) |
| InChIKey | YSIYXBSPHPWZHH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|