C13H18Br2N2 — CID 166643201
1-(4-bromobutyl)-2,3-dimethylbenzimidazol-3-ium bromide (PubChem CID 166643201) has the molecular formula C13H18Br2N2 and a molecular weight of 362.11 g/mol. Its IUPAC name is 1-(4-bromobutyl)-2,3-dimethylbenzimidazol-3-ium bromide.
| Compound Name | 1-(4-bromobutyl)-2,3-dimethylbenzimidazol-3-ium bromide |
|---|---|
| PubChem CID | 166643201 |
| Molecular Formula | C13H18Br2N2 |
| Molecular Weight | 362.11 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 1-(4-bromobutyl)-2,3-dimethylbenzimidazol-3-ium bromide |
| SMILES | Cc1n(CCCCBr)c2ccccc2[n+]1C.[Br-] |
| InChI | InChI=1S/C13H18BrN2.BrH/c1-11-15(2)12-7-3-4-8-13(12)16(11)10-6-5-9-14;/h3-4,7-8H,5-6,9-10H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | CZMVSZJJBDYXLE-UHFFFAOYSA-M |
| XLogP | -0.05 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.11 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|