C10H10BrF2N2+ — CID 15499449
1-[bromo(difluoro)methyl]-2,3-dimethylbenzimidazol-3-ium (PubChem CID 15499449) has the molecular formula C10H10BrF2N2+ and a molecular weight of 276.10 g/mol. Its IUPAC name is 1-[bromo(difluoro)methyl]-2,3-dimethylbenzimidazol-3-ium.
| Compound Name | 1-[bromo(difluoro)methyl]-2,3-dimethylbenzimidazol-3-ium |
|---|---|
| PubChem CID | 15499449 |
| Molecular Formula | C10H10BrF2N2+ |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 1-[bromo(difluoro)methyl]-2,3-dimethylbenzimidazol-3-ium |
| SMILES | Cc1n(C(F)(F)Br)c2ccccc2[n+]1C |
| InChI | InChI=1S/C10H10BrF2N2/c1-7-14(2)8-5-3-4-6-9(8)15(7)10(11,12)13/h3-6H,1-2H3/q+1 |
| InChIKey | IDEHXDDVGLAGRO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|