C12H16ClIN2 — CID 166643193
1-(3-chloropropyl)-2,3-dimethylbenzimidazol-3-ium iodide (PubChem CID 166643193) has the molecular formula C12H16ClIN2 and a molecular weight of 350.63 g/mol. Its IUPAC name is 1-(3-chloropropyl)-2,3-dimethylbenzimidazol-3-ium iodide.
| Compound Name | 1-(3-chloropropyl)-2,3-dimethylbenzimidazol-3-ium iodide |
|---|---|
| PubChem CID | 166643193 |
| Molecular Formula | C12H16ClIN2 |
| Molecular Weight | 350.63 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 1-(3-chloropropyl)-2,3-dimethylbenzimidazol-3-ium iodide |
| SMILES | Cc1n(CCCCl)c2ccccc2[n+]1C.[I-] |
| InChI | InChI=1S/C12H16ClN2.HI/c1-10-14(2)11-6-3-4-7-12(11)15(10)9-5-8-13;/h3-4,6-7H,5,8-9H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ZWMAHMAISJPZRV-UHFFFAOYSA-M |
| XLogP | -0.59 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.63 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|