C22H29N4+3 — CID 166057326
1-[4-(2,3-dimethyl-1H-benzimidazole-1,3-diium-1-yl)butyl]-2,3-dimethylbenzimidazol-3-ium (PubChem CID 166057326) has the molecular formula C22H29N4+3 and a molecular weight of 349.50 g/mol. Its IUPAC name is 1-[4-(2,3-dimethyl-1H-benzimidazole-1,3-diium-1-yl)butyl]-2,3-dimethylbenzimidazol-3-ium.
| Compound Name | 1-[4-(2,3-dimethyl-1H-benzimidazole-1,3-diium-1-yl)butyl]-2,3-dimethylbenzimidazol-3-ium |
|---|---|
| PubChem CID | 166057326 |
| Molecular Formula | C22H29N4+3 |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 1-[4-(2,3-dimethyl-1H-benzimidazole-1,3-diium-1-yl)butyl]-2,3-dimethylbenzimidazol-3-ium |
| SMILES | CC1=[N+](C)c2ccccc2[NH+]1CCCCn1c(C)[n+](C)c2ccccc21 |
| InChI | InChI=1S/C22H28N4/c1-17-23(3)19-11-5-7-13-21(19)25(17)15-9-10-16-26-18(2)24(4)20-12-6-8-14-22(20)26/h5-8,11-14H,9-10,15-16H2,1-4H3/q+2/p+1 |
| InChIKey | OZSQYAZASHTEBV-UHFFFAOYSA-O |
| XLogP | 2.48 |
| TPSA | 16.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|