C17H20N2O3S — CID 90928563
1-benzyl-2,3-dimethylbenzimidazol-3-ium;methanesulfonate (PubChem CID 90928563) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-benzyl-2,3-dimethylbenzimidazol-3-ium;methanesulfonate.
| Compound Name | 1-benzyl-2,3-dimethylbenzimidazol-3-ium;methanesulfonate |
|---|---|
| PubChem CID | 90928563 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-benzyl-2,3-dimethylbenzimidazol-3-ium;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].Cc1n(Cc2ccccc2)c2ccccc2[n+]1C |
| InChI | InChI=1S/C16H17N2.CH4O3S/c1-13-17(2)15-10-6-7-11-16(15)18(13)12-14-8-4-3-5-9-14;1-5(2,3)4/h3-11H,12H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | ODWJZUUJXXKFPH-UHFFFAOYSA-M |
| XLogP | 1.98 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|