C16H24IN2+ — CID 135045436
2-iodo-1-methyl-3-octylbenzimidazol-1-ium (PubChem CID 135045436) has the molecular formula C16H24IN2+ and a molecular weight of 371.29 g/mol. Its IUPAC name is 2-iodo-1-methyl-3-octylbenzimidazol-1-ium.
| Compound Name | 2-iodo-1-methyl-3-octylbenzimidazol-1-ium |
|---|---|
| PubChem CID | 135045436 |
| Molecular Formula | C16H24IN2+ |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-iodo-1-methyl-3-octylbenzimidazol-1-ium |
| SMILES | CCCCCCCCn1c(I)[n+](C)c2ccccc21 |
| InChI | InChI=1S/C16H24IN2/c1-3-4-5-6-7-10-13-19-15-12-9-8-11-14(15)18(2)16(19)17/h8-9,11-12H,3-7,10,13H2,1-2H3/q+1 |
| InChIKey | AZVUGTIOMJBURN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|