About benzene;9-octylcarbazole
benzene;9-octylcarbazole (PubChem CID 175067369) has the molecular formula C26H31N
and a molecular weight of 357.54 g/mol. Its IUPAC name is benzene;9-octylcarbazole.
Molecular Properties
| Compound Name | benzene;9-octylcarbazole |
| PubChem CID | 175067369 |
| Molecular Formula | C26H31N |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | benzene;9-octylcarbazole |
| SMILES | CCCCCCCCn1c2ccccc2c2ccccc21.c1ccccc1 |
| InChI | InChI=1S/C20H25N.C6H6/c1-2-3-4-5-6-11-16-21-19-14-9-7-12-17(19)18-13-8-10-15-20(18)21;1-2-4-6-5-3-1/h7-10,12-15H,2-6,11,16H2,1H3;1-6H |
| InChIKey | HSQVDRREDLLJBP-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzene;9-octylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;9-octylcarbazole?
The IUPAC name of benzene;9-octylcarbazole (CID 175067369) is benzene;9-octylcarbazole.
What is the SMILES notation for benzene;9-octylcarbazole?
The canonical SMILES for benzene;9-octylcarbazole is CCCCCCCCn1c2ccccc2c2ccccc21.c1ccccc1.
What is the InChIKey of benzene;9-octylcarbazole?
The InChIKey is HSQVDRREDLLJBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N.C6H6/c1-2-3-4-5-6-11-16-21-19-14-9-7-12-17(19)18-13-8-10-15-20(18)21;1-2-4-6-5-3-1/h7-10,12-15H,2-6,11,16H2,1H3;1-6H.
What are the key properties of benzene;9-octylcarbazole?
benzene;9-octylcarbazole has a molecular weight of 357.54 g/mol, XLogP of 7.84, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;9-octylcarbazole is sourced from PubChem (CID 175067369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).