C20H25NO — CID 160567195
9-octylcarbazol-1-ol (PubChem CID 160567195) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 9-octylcarbazol-1-ol.
| Compound Name | 9-octylcarbazol-1-ol |
|---|---|
| PubChem CID | 160567195 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 9-octylcarbazol-1-ol |
| SMILES | CCCCCCCCn1c2ccccc2c2cccc(O)c21 |
| InChI | InChI=1S/C20H25NO/c1-2-3-4-5-6-9-15-21-18-13-8-7-11-16(18)17-12-10-14-19(22)20(17)21/h7-8,10-14,22H,2-6,9,15H2,1H3 |
| InChIKey | DFVPRJDBJQDRRL-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|