C21H25N — CID 162355776
1-ethenyl-9-heptylcarbazole (PubChem CID 162355776) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-ethenyl-9-heptylcarbazole.
| Compound Name | 1-ethenyl-9-heptylcarbazole |
|---|---|
| PubChem CID | 162355776 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 1-ethenyl-9-heptylcarbazole |
| SMILES | C=Cc1cccc2c3ccccc3n(CCCCCCC)c12 |
| InChI | InChI=1S/C21H25N/c1-3-5-6-7-10-16-22-20-15-9-8-13-18(20)19-14-11-12-17(4-2)21(19)22/h4,8-9,11-15H,2-3,5-7,10,16H2,1H3 |
| InChIKey | NKLBOJQSYNDAJX-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|