C18H19Br2N — CID 141427471
1,2-dibromo-9-hexylcarbazole (PubChem CID 141427471) has the molecular formula C18H19Br2N and a molecular weight of 409.17 g/mol. Its IUPAC name is 1,2-dibromo-9-hexylcarbazole.
| Compound Name | 1,2-dibromo-9-hexylcarbazole |
|---|---|
| PubChem CID | 141427471 |
| Molecular Formula | C18H19Br2N |
| Molecular Weight | 409.17 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | 1,2-dibromo-9-hexylcarbazole |
| SMILES | CCCCCCn1c2ccccc2c2ccc(Br)c(Br)c21 |
| InChI | InChI=1S/C18H19Br2N/c1-2-3-4-7-12-21-16-9-6-5-8-13(16)14-10-11-15(19)17(20)18(14)21/h5-6,8-11H,2-4,7,12H2,1H3 |
| InChIKey | WKSJFJQBTQFCRV-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.17 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|