C19H22ClN2O2+ — CID 2885554
1-(2-chloro-5-methylphenoxy)-3-(2,3-dimethylbenzimidazol-3-ium-1-yl)propan-2-ol (PubChem CID 2885554) has the molecular formula C19H22ClN2O2+ and a molecular weight of 345.85 g/mol. Its IUPAC name is 1-(2-chloro-5-methylphenoxy)-3-(2,3-dimethylbenzimidazol-3-ium-1-yl)propan-2-ol.
| Compound Name | 1-(2-chloro-5-methylphenoxy)-3-(2,3-dimethylbenzimidazol-3-ium-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 2885554 |
| Molecular Formula | C19H22ClN2O2+ |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-(2-chloro-5-methylphenoxy)-3-(2,3-dimethylbenzimidazol-3-ium-1-yl)propan-2-ol |
| SMILES | Cc1ccc(Cl)c(OCC(O)Cn2c(C)[n+](C)c3ccccc32)c1 |
| InChI | InChI=1S/C19H22ClN2O2/c1-13-8-9-16(20)19(10-13)24-12-15(23)11-22-14(2)21(3)17-6-4-5-7-18(17)22/h4-10,15,23H,11-12H2,1-3H3/q+1 |
| InChIKey | HIJSDTDPOQRQQG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|