C20H24ClN2O2+ — CID 2885248
1-(2-chloro-5-methylphenoxy)-3-(3,5,6-trimethylbenzimidazol-3-ium-1-yl)propan-2-ol (PubChem CID 2885248) has the molecular formula C20H24ClN2O2+ and a molecular weight of 359.88 g/mol. Its IUPAC name is 1-(2-chloro-5-methylphenoxy)-3-(3,5,6-trimethylbenzimidazol-3-ium-1-yl)propan-2-ol.
| Compound Name | 1-(2-chloro-5-methylphenoxy)-3-(3,5,6-trimethylbenzimidazol-3-ium-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 2885248 |
| Molecular Formula | C20H24ClN2O2+ |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-(2-chloro-5-methylphenoxy)-3-(3,5,6-trimethylbenzimidazol-3-ium-1-yl)propan-2-ol |
| SMILES | Cc1ccc(Cl)c(OCC(O)Cn2c[n+](C)c3cc(C)c(C)cc32)c1 |
| InChI | InChI=1S/C20H24ClN2O2/c1-13-5-6-17(21)20(7-13)25-11-16(24)10-23-12-22(4)18-8-14(2)15(3)9-19(18)23/h5-9,12,16,24H,10-11H2,1-4H3/q+1 |
| InChIKey | VXPHDGLGODKJDT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|