C21H21N2O2+ — CID 40503008
(2R)-1-(3-methylbenzimidazol-3-ium-1-yl)-3-naphthalen-1-yloxypropan-2-ol (PubChem CID 40503008) has the molecular formula C21H21N2O2+ and a molecular weight of 333.41 g/mol. Its IUPAC name is (2R)-1-(3-methylbenzimidazol-3-ium-1-yl)-3-naphthalen-1-yloxypropan-2-ol.
| Compound Name | (2R)-1-(3-methylbenzimidazol-3-ium-1-yl)-3-naphthalen-1-yloxypropan-2-ol |
|---|---|
| PubChem CID | 40503008 |
| Molecular Formula | C21H21N2O2+ |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (2R)-1-(3-methylbenzimidazol-3-ium-1-yl)-3-naphthalen-1-yloxypropan-2-ol |
| SMILES | C[n+]1cn(C[C@@H](O)COc2cccc3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C21H21N2O2/c1-22-15-23(20-11-5-4-10-19(20)22)13-17(24)14-25-21-12-6-8-16-7-2-3-9-18(16)21/h2-12,15,17,24H,13-14H2,1H3/q+1/t17-/m1/s1 |
| InChIKey | GSXLDFWCFBUJTN-QGZVFWFLSA-N |
| XLogP | 3.06 |
| TPSA | 38.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|